C34H25Cl2FN2O8 — CID 4065433
3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 4065433) has the molecular formula C34H25Cl2FN2O8 and a molecular weight of 679.48 g/mol. Its IUPAC name is 3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4065433 |
| Molecular Formula | C34H25Cl2FN2O8 |
| Molecular Weight | 679.48 g/mol |
| Exact Mass | 678.10 |
| IUPAC Name | 3-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(3-hydroxy-4-methoxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(c5cccc(C(=O)O)c5)C(=O)C4C3CC3(Cl)C(=O)N(c4ccc(F)cc4)C(=O)C23Cl)cc1O |
| InChI | InChI=1S/C34H25Cl2FN2O8/c1-47-25-12-5-16(14-24(25)40)27-21-10-11-22-26(29(42)38(28(22)41)20-4-2-3-17(13-20)30(43)44)23(21)15-33(35)31(45)39(32(46)34(27,33)36)19-8-6-18(37)7-9-19/h2-10,12-14,22-23,26-27,40H,11,15H2,1H3,(H,43,44) |
| InChIKey | KNMYMTMUTZIFBD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|