C26H22ClN5 — CID 4065447
1-N-[7-(3-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]-4-N,4-N-dimethylbenzene-1,4-diamine (PubChem CID 4065447) has the molecular formula C26H22ClN5 and a molecular weight of 439.95 g/mol. Its IUPAC name is 1-N-[7-(3-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]-4-N,4-N-dimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[7-(3-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]-4-N,4-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 4065447 |
| Molecular Formula | C26H22ClN5 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-N-[7-(3-chlorophenyl)-5-phenylpyrrolo[2,3-d]pyrimidin-4-yl]-4-N,4-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(Nc2ncnc3c2c(-c2ccccc2)cn3-c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C26H22ClN5/c1-31(2)21-13-11-20(12-14-21)30-25-24-23(18-7-4-3-5-8-18)16-32(26(24)29-17-28-25)22-10-6-9-19(27)15-22/h3-17H,1-2H3,(H,28,29,30) |
| InChIKey | UBJLTAPCALGKPX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|