C47H53F3N2O5 — CID 4065563
1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 4065563) has the molecular formula C47H53F3N2O5 and a molecular weight of 782.94 g/mol. Its IUPAC name is 1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 4065563 |
| Molecular Formula | C47H53F3N2O5 |
| Molecular Weight | 782.94 g/mol |
| Exact Mass | 782.39 |
| IUPAC Name | 1-[[5,13-dihydroxy-6,10-dimethyl-17-(4-phenylbenzoyl)-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-3-propan-2-yl-1-[[4-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccc(OC(F)(F)F)cc2)C(=O)NC(C)C)c2ccc(cc2C(=O)c2ccc(-c3ccccc3)cc2)CC(O)CC1 |
| InChI | InChI=1S/C47H53F3N2O5/c1-31(2)51-44(55)52(29-33-13-21-39(22-14-33)57-47(48,49)50)30-46(56)26-24-42-40-23-15-34(27-38(53)20-12-32(3)9-8-25-45(42,46)4)28-41(40)43(54)37-18-16-36(17-19-37)35-10-6-5-7-11-35/h5-7,9-11,13-19,21-23,28,31,38,42,53,56H,8,12,20,24-27,29-30H2,1-4H3,(H,51,55) |
| InChIKey | MKIDTGJMZVNZGF-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.94 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|