C18H18N6O4 — CID 4065674
ethyl 2-[10-(2-ethoxy-2-oxoethyl)-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaen-3-yl]acetate (PubChem CID 4065674) has the molecular formula C18H18N6O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is ethyl 2-[10-(2-ethoxy-2-oxoethyl)-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaen-3-yl]acetate.
| Compound Name | ethyl 2-[10-(2-ethoxy-2-oxoethyl)-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaen-3-yl]acetate |
|---|---|
| PubChem CID | 4065674 |
| Molecular Formula | C18H18N6O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | ethyl 2-[10-(2-ethoxy-2-oxoethyl)-2,4,5,8,9,11-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaen-3-yl]acetate |
| SMILES | CCOC(=O)Cc1nnc2c3nnc(CC(=O)OCC)n3c3ccccc3n12 |
| InChI | InChI=1S/C18H18N6O4/c1-3-27-15(25)9-13-19-21-17-18-22-20-14(10-16(26)28-4-2)24(18)12-8-6-5-7-11(12)23(13)17/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | BLWZDFPTICDWJQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 112.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |