About N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide
N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide (PubChem CID 4066030) has the molecular formula C10H10N4O2S2
and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 4066030 |
| Molecular Formula | C10H10N4O2S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(-c2csc(NC(C)=O)n2)cs1 |
| InChI | InChI=1S/C10H10N4O2S2/c1-5(15)11-9-13-7(3-17-9)8-4-18-10(14-8)12-6(2)16/h3-4H,1-2H3,(H,11,13,15)(H,12,14,16) |
| InChIKey | UMUKGXGCTJGJFM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide (CID 4066030) is N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1nc(-c2csc(NC(C)=O)n2)cs1.
What is the InChIKey of N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide?
The InChIKey is UMUKGXGCTJGJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O2S2/c1-5(15)11-9-13-7(3-17-9)8-4-18-10(14-8)12-6(2)16/h3-4H,1-2H3,(H,11,13,15)(H,12,14,16).
What are the key properties of N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide?
N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide has a molecular weight of 282.35 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-acetamido-1,3-thiazol-4-yl)-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 4066030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).