C15H14F11NO — CID 4066063
N-[2-(cyclohexen-1-yl)ethyl]-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide (PubChem CID 4066063) has the molecular formula C15H14F11NO and a molecular weight of 433.26 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 4066063 |
| Molecular Formula | C15H14F11NO |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane-1-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C15H14F11NO/c16-10(9(28)27-7-6-8-4-2-1-3-5-8)11(17,18)13(21,22)15(25,26)14(23,24)12(10,19)20/h4H,1-3,5-7H2,(H,27,28) |
| InChIKey | UNFBXIPWCHMQON-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|