About ethyl buta-2,3-dienoate
ethyl buta-2,3-dienoate (PubChem CID 4066088) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is ethyl buta-2,3-dienoate.
Molecular Properties
| Compound Name | ethyl buta-2,3-dienoate |
| PubChem CID | 4066088 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | ethyl buta-2,3-dienoate |
| SMILES | C=C=CC(=O)OCC |
| InChI | InChI=1S/C6H8O2/c1-3-5-6(7)8-4-2/h5H,1,4H2,2H3 |
| InChIKey | GLSUOACRAMLJIW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl buta-2,3-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl buta-2,3-dienoate?
The IUPAC name of ethyl buta-2,3-dienoate (CID 4066088) is ethyl buta-2,3-dienoate.
What is the SMILES notation for ethyl buta-2,3-dienoate?
The canonical SMILES for ethyl buta-2,3-dienoate is C=C=CC(=O)OCC.
What is the InChIKey of ethyl buta-2,3-dienoate?
The InChIKey is GLSUOACRAMLJIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2/c1-3-5-6(7)8-4-2/h5H,1,4H2,2H3.
What are the key properties of ethyl buta-2,3-dienoate?
ethyl buta-2,3-dienoate has a molecular weight of 112.13 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl buta-2,3-dienoate is sourced from PubChem (CID 4066088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).