C13H14ClN5OS — CID 40663409
(2S)-2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(5-chloro-2-pyridinyl)propanamide (PubChem CID 40663409) has the molecular formula C13H14ClN5OS and a molecular weight of 323.81 g/mol. Its IUPAC name is (2S)-2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(5-chloro-2-pyridinyl)propanamide.
| Compound Name | (2S)-2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(5-chloro-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 40663409 |
| Molecular Formula | C13H14ClN5OS |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (2S)-2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-(5-chloro-2-pyridinyl)propanamide |
| SMILES | Cc1cc(N)nc(S[C@@H](C)C(=O)Nc2ccc(Cl)cn2)n1 |
| InChI | InChI=1S/C13H14ClN5OS/c1-7-5-10(15)18-13(17-7)21-8(2)12(20)19-11-4-3-9(14)6-16-11/h3-6,8H,1-2H3,(H2,15,17,18)(H,16,19,20)/t8-/m0/s1 |
| InChIKey | WQCCDFVCQJNQFY-QMMMGPOBSA-N |
| XLogP | 2.53 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |