About 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole
2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole (PubChem CID 4066362) has the molecular formula C21H13N3S2
and a molecular weight of 371.49 g/mol. Its IUPAC name is 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole |
| PubChem CID | 4066362 |
| Molecular Formula | C21H13N3S2 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole |
| SMILES | C(=C(c1nc2ccccc2s1)c1nc2ccccc2s1)c1ccccn1 |
| InChI | InChI=1S/C21H13N3S2/c1-3-10-18-16(8-1)23-20(25-18)15(13-14-7-5-6-12-22-14)21-24-17-9-2-4-11-19(17)26-21/h1-13H |
| InChIKey | VPKQZRNAUKQLOH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole?
The IUPAC name of 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole (CID 4066362) is 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole.
What is the SMILES notation for 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole?
The canonical SMILES for 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole is C(=C(c1nc2ccccc2s1)c1nc2ccccc2s1)c1ccccn1.
What is the InChIKey of 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole?
The InChIKey is VPKQZRNAUKQLOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13N3S2/c1-3-10-18-16(8-1)23-20(25-18)15(13-14-7-5-6-12-22-14)21-24-17-9-2-4-11-19(17)26-21/h1-13H.
What are the key properties of 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole?
2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole has a molecular weight of 371.49 g/mol, XLogP of 5.89, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1,3-benzothiazol-2-yl)-2-pyridin-2-ylethenyl]-1,3-benzothiazole is sourced from PubChem (CID 4066362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).