C15H16ClN3O2 — CID 4067100
4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide (PubChem CID 4067100) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.77 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide.
| Compound Name | 4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 4067100 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxamide |
| SMILES | CC1=C(C(N)=O)C(c2ccc(Cl)cc2)C(C(N)=O)=C(C)N1 |
| InChI | InChI=1S/C15H16ClN3O2/c1-7-11(14(17)20)13(9-3-5-10(16)6-4-9)12(15(18)21)8(2)19-7/h3-6,13,19H,1-2H3,(H2,17,20)(H2,18,21) |
| InChIKey | QUXMLICLYCGYIL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |