About 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide
2-N,5-N-dihydroxyfuran-2,5-dicarboxamide (PubChem CID 4067148) has the molecular formula C6H6N2O5
and a molecular weight of 186.12 g/mol. Its IUPAC name is 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide |
| PubChem CID | 4067148 |
| Molecular Formula | C6H6N2O5 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide |
| SMILES | O=C(NO)c1ccc(C(=O)NO)o1 |
| InChI | InChI=1S/C6H6N2O5/c9-5(7-11)3-1-2-4(13-3)6(10)8-12/h1-2,11-12H,(H,7,9)(H,8,10) |
| InChIKey | PJWJTAUUGOFUIE-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide?
The IUPAC name of 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide (CID 4067148) is 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide.
What is the SMILES notation for 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide?
The canonical SMILES for 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide is O=C(NO)c1ccc(C(=O)NO)o1.
What is the InChIKey of 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide?
The InChIKey is PJWJTAUUGOFUIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O5/c9-5(7-11)3-1-2-4(13-3)6(10)8-12/h1-2,11-12H,(H,7,9)(H,8,10).
What are the key properties of 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide?
2-N,5-N-dihydroxyfuran-2,5-dicarboxamide has a molecular weight of 186.12 g/mol, XLogP of -0.48, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,5-N-dihydroxyfuran-2,5-dicarboxamide is sourced from PubChem (CID 4067148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).