C19H11Cl2N3O7S — CID 4067565
methyl 2-[(4-chloro-3,5-dinitrobenzoyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylate (PubChem CID 4067565) has the molecular formula C19H11Cl2N3O7S and a molecular weight of 496.28 g/mol. Its IUPAC name is methyl 2-[(4-chloro-3,5-dinitrobenzoyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(4-chloro-3,5-dinitrobenzoyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4067565 |
| Molecular Formula | C19H11Cl2N3O7S |
| Molecular Weight | 496.28 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | methyl 2-[(4-chloro-3,5-dinitrobenzoyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H11Cl2N3O7S/c1-31-19(26)15-12(9-2-4-11(20)5-3-9)8-32-18(15)22-17(25)10-6-13(23(27)28)16(21)14(7-10)24(29)30/h2-8H,1H3,(H,22,25) |
| InChIKey | ZPRCWMAXRBAAOJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.28 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|