C10H12NO3S- — CID 4067887
3-methyl-2-(thiophene-2-carbonylamino)butanoate (PubChem CID 4067887) has the molecular formula C10H12NO3S- and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-methyl-2-(thiophene-2-carbonylamino)butanoate.
| Compound Name | 3-methyl-2-(thiophene-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 4067887 |
| Molecular Formula | C10H12NO3S- |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 3-methyl-2-(thiophene-2-carbonylamino)butanoate |
| SMILES | CC(C)C(NC(=O)c1cccs1)C(=O)[O-] |
| InChI | InChI=1S/C10H13NO3S/c1-6(2)8(10(13)14)11-9(12)7-4-3-5-15-7/h3-6,8H,1-2H3,(H,11,12)(H,13,14)/p-1 |
| InChIKey | RXZNSDOUKYEHDZ-UHFFFAOYSA-M |
| XLogP | 0.25 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |