C26H25N2O3P — CID 4068034
1,3-diethyl-5-(triphenyl-λ5-phosphanylidene)-1,3-diazinane-2,4,6-trione (PubChem CID 4068034) has the molecular formula C26H25N2O3P and a molecular weight of 444.47 g/mol. Its IUPAC name is 1,3-diethyl-5-(triphenyl-λ5-phosphanylidene)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-diethyl-5-(triphenyl-λ5-phosphanylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 4068034 |
| Molecular Formula | C26H25N2O3P |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 1,3-diethyl-5-(triphenyl-λ5-phosphanylidene)-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)C(=P(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C26H25N2O3P/c1-3-27-24(29)23(25(30)28(4-2)26(27)31)32(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22/h5-19H,3-4H2,1-2H3 |
| InChIKey | VNSWOFNNLLUFQY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|