C22H29N5O2 — CID 4068337
N-benzyl-N-[3-oxo-3-(2-piperidin-1-ylethylamino)propyl]pyrazine-2-carboxamide (PubChem CID 4068337) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-benzyl-N-[3-oxo-3-(2-piperidin-1-ylethylamino)propyl]pyrazine-2-carboxamide.
| Compound Name | N-benzyl-N-[3-oxo-3-(2-piperidin-1-ylethylamino)propyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 4068337 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | N-benzyl-N-[3-oxo-3-(2-piperidin-1-ylethylamino)propyl]pyrazine-2-carboxamide |
| SMILES | O=C(CCN(Cc1ccccc1)C(=O)c1cnccn1)NCCN1CCCCC1 |
| InChI | InChI=1S/C22H29N5O2/c28-21(25-12-16-26-13-5-2-6-14-26)9-15-27(18-19-7-3-1-4-8-19)22(29)20-17-23-10-11-24-20/h1,3-4,7-8,10-11,17H,2,5-6,9,12-16,18H2,(H,25,28) |
| InChIKey | KNLIUYTZMULJFW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |