C18H22N4OS2 — CID 40684509
2-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide (PubChem CID 40684509) has the molecular formula C18H22N4OS2 and a molecular weight of 374.54 g/mol. Its IUPAC name is 2-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide.
| Compound Name | 2-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 40684509 |
| Molecular Formula | C18H22N4OS2 |
| Molecular Weight | 374.54 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CSc1nnc(Cc2cccs2)n1C1CCCCC1 |
| InChI | InChI=1S/C18H22N4OS2/c1-2-10-19-17(23)13-25-18-21-20-16(12-15-9-6-11-24-15)22(18)14-7-4-3-5-8-14/h1,6,9,11,14H,3-5,7-8,10,12-13H2,(H,19,23) |
| InChIKey | VZGCTAHTWDRIDF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|