C20H18N2O3S2 — CID 40694942
N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methylsulfanylbenzamide (PubChem CID 40694942) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methylsulfanylbenzamide.
| Compound Name | N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 40694942 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-(4,7-dimethoxy-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)-3-methylsulfanylbenzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2cccc(SC)c2)sc2c(OC)ccc(OC)c21 |
| InChI | InChI=1S/C20H18N2O3S2/c1-5-11-22-17-15(24-2)9-10-16(25-3)18(17)27-20(22)21-19(23)13-7-6-8-14(12-13)26-4/h1,6-10,12H,11H2,2-4H3/b21-20- |
| InChIKey | ONKIBRDEIPTVNI-MRCUWXFGSA-N |
| XLogP | 3.82 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|