About 2,2,2-trichloro-N,N-dipropylacetamide
2,2,2-trichloro-N,N-dipropylacetamide (PubChem CID 4069521) has the molecular formula C8H14Cl3NO
and a molecular weight of 246.56 g/mol. Its IUPAC name is 2,2,2-trichloro-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2,2,2-trichloro-N,N-dipropylacetamide |
| PubChem CID | 4069521 |
| Molecular Formula | C8H14Cl3NO |
| Molecular Weight | 246.56 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 2,2,2-trichloro-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H14Cl3NO/c1-3-5-12(6-4-2)7(13)8(9,10)11/h3-6H2,1-2H3 |
| InChIKey | CNGCKIPJXZLLDA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloro-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloro-N,N-dipropylacetamide?
The IUPAC name of 2,2,2-trichloro-N,N-dipropylacetamide (CID 4069521) is 2,2,2-trichloro-N,N-dipropylacetamide.
What is the SMILES notation for 2,2,2-trichloro-N,N-dipropylacetamide?
The canonical SMILES for 2,2,2-trichloro-N,N-dipropylacetamide is CCCN(CCC)C(=O)C(Cl)(Cl)Cl.
What is the InChIKey of 2,2,2-trichloro-N,N-dipropylacetamide?
The InChIKey is CNGCKIPJXZLLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14Cl3NO/c1-3-5-12(6-4-2)7(13)8(9,10)11/h3-6H2,1-2H3.
What are the key properties of 2,2,2-trichloro-N,N-dipropylacetamide?
2,2,2-trichloro-N,N-dipropylacetamide has a molecular weight of 246.56 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloro-N,N-dipropylacetamide is sourced from PubChem (CID 4069521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).