C24H27N3O4 — CID 40698436
[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetate (PubChem CID 40698436) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is [2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetate.
| Compound Name | [2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 40698436 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | [2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl] 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetate |
| SMILES | Cc1cccc(OCCNC(=O)COC(=O)Cc2c(C)nn(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C24H27N3O4/c1-17-8-7-11-21(14-17)30-13-12-25-23(28)16-31-24(29)15-22-18(2)26-27(19(22)3)20-9-5-4-6-10-20/h4-11,14H,12-13,15-16H2,1-3H3,(H,25,28) |
| InChIKey | WUTKBLUZZXTDQU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|