C12H11F9N2O4S2 — CID 4070422
4-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl]benzenesulfonamide (PubChem CID 4070422) has the molecular formula C12H11F9N2O4S2 and a molecular weight of 482.35 g/mol. Its IUPAC name is 4-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl]benzenesulfonamide.
| Compound Name | 4-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4070422 |
| Molecular Formula | C12H11F9N2O4S2 |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 4-[2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H11F9N2O4S2/c13-9(14,11(17,18)19)10(15,16)12(20,21)29(26,27)23-6-5-7-1-3-8(4-2-7)28(22,24)25/h1-4,23H,5-6H2,(H2,22,24,25) |
| InChIKey | LGEFNMHGQQWZJQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|