About N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide
N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide (PubChem CID 4070775) has the molecular formula C16H32N2O2
and a molecular weight of 284.44 g/mol. Its IUPAC name is N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide |
| PubChem CID | 4070775 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)NCCCCNC(=O)CC(C)(C)C |
| InChI | InChI=1S/C16H32N2O2/c1-15(2,3)11-13(19)17-9-7-8-10-18-14(20)12-16(4,5)6/h7-12H2,1-6H3,(H,17,19)(H,18,20) |
| InChIKey | YMUVMGKAFBOMOW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide?
The IUPAC name of N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide (CID 4070775) is N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide.
What is the SMILES notation for N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide?
The canonical SMILES for N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide is CC(C)(C)CC(=O)NCCCCNC(=O)CC(C)(C)C.
What is the InChIKey of N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide?
The InChIKey is YMUVMGKAFBOMOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O2/c1-15(2,3)11-13(19)17-9-7-8-10-18-14(20)12-16(4,5)6/h7-12H2,1-6H3,(H,17,19)(H,18,20).
What are the key properties of N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide?
N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide has a molecular weight of 284.44 g/mol, XLogP of 2.87, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,3-dimethylbutanoylamino)butyl]-3,3-dimethylbutanamide is sourced from PubChem (CID 4070775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).