C29H22F5N5O — CID 4070961
N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-5-methyl-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 4070961) has the molecular formula C29H22F5N5O and a molecular weight of 551.52 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-5-methyl-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-5-methyl-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 4070961 |
| Molecular Formula | C29H22F5N5O |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-5-methyl-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | Cc1nn(Cc2c(F)c(F)c(F)c(F)c2F)c(C)c1NC(=O)c1c(-c2ccccc2)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C29H22F5N5O/c1-15-27(17(3)38(36-15)14-20-22(30)24(32)26(34)25(33)23(20)31)35-29(40)21-16(2)39(19-12-8-5-9-13-19)37-28(21)18-10-6-4-7-11-18/h4-13H,14H2,1-3H3,(H,35,40) |
| InChIKey | MMJDUMBLIYVHIZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|