C17H22N2O3 — CID 40711295
N-[(2S)-butan-2-yl]-2-(6-methoxy-2-methylquinolin-4-yl)oxyacetamide (PubChem CID 40711295) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-(6-methoxy-2-methylquinolin-4-yl)oxyacetamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-(6-methoxy-2-methylquinolin-4-yl)oxyacetamide |
|---|---|
| PubChem CID | 40711295 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-(6-methoxy-2-methylquinolin-4-yl)oxyacetamide |
| SMILES | CC[C@H](C)NC(=O)COc1cc(C)nc2ccc(OC)cc12 |
| InChI | InChI=1S/C17H22N2O3/c1-5-11(2)19-17(20)10-22-16-8-12(3)18-15-7-6-13(21-4)9-14(15)16/h6-9,11H,5,10H2,1-4H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | JZCKYDWXTPAVQJ-NSHDSACASA-N |
| XLogP | 2.85 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |