C13H16N4O — CID 4071477
6-methyl-5-(2,4,6-trimethylanilino)-2H-1,2,4-triazin-3-one (PubChem CID 4071477) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 6-methyl-5-(2,4,6-trimethylanilino)-2H-1,2,4-triazin-3-one.
| Compound Name | 6-methyl-5-(2,4,6-trimethylanilino)-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 4071477 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 6-methyl-5-(2,4,6-trimethylanilino)-2H-1,2,4-triazin-3-one |
| SMILES | Cc1cc(C)c(Nc2nc(=O)[nH]nc2C)c(C)c1 |
| InChI | InChI=1S/C13H16N4O/c1-7-5-8(2)11(9(3)6-7)14-12-10(4)16-17-13(18)15-12/h5-6H,1-4H3,(H2,14,15,17,18) |
| InChIKey | YSPHDXODWMEBOP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |