C19H19FN4O3 — CID 40715877
1-(2,5-dimethoxyphenyl)-3-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]urea (PubChem CID 40715877) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 40715877 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2cnn(Cc3ccccc3F)c2)c1 |
| InChI | InChI=1S/C19H19FN4O3/c1-26-15-7-8-18(27-2)17(9-15)23-19(25)22-14-10-21-24(12-14)11-13-5-3-4-6-16(13)20/h3-10,12H,11H2,1-2H3,(H2,22,23,25) |
| InChIKey | LXAOCNPXCKEQFT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |