C22H16N2O3 — CID 40715931
(6aS)-6-(4-methoxyphenyl)-6aH-isoindolo[2,3-a]quinazoline-5,11-dione (PubChem CID 40715931) has the molecular formula C22H16N2O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is (6aS)-6-(4-methoxyphenyl)-6aH-isoindolo[2,3-a]quinazoline-5,11-dione.
| Compound Name | (6aS)-6-(4-methoxyphenyl)-6aH-isoindolo[2,3-a]quinazoline-5,11-dione |
|---|---|
| PubChem CID | 40715931 |
| Molecular Formula | C22H16N2O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (6aS)-6-(4-methoxyphenyl)-6aH-isoindolo[2,3-a]quinazoline-5,11-dione |
| SMILES | COc1ccc(N2C(=O)c3ccccc3N3C(=O)c4ccccc4[C@@H]23)cc1 |
| InChI | InChI=1S/C22H16N2O3/c1-27-15-12-10-14(11-13-15)23-20-16-6-2-3-7-17(16)21(25)24(20)19-9-5-4-8-18(19)22(23)26/h2-13,20H,1H3/t20-/m0/s1 |
| InChIKey | JFDQXXNLGLRINN-FQEVSTJZSA-N |
| XLogP | 4.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |