C16H15ClN4O — CID 40716431
6-chloro-N-[2-(2-methylbenzimidazol-1-yl)ethyl]pyridine-3-carboxamide (PubChem CID 40716431) has the molecular formula C16H15ClN4O and a molecular weight of 314.78 g/mol. Its IUPAC name is 6-chloro-N-[2-(2-methylbenzimidazol-1-yl)ethyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[2-(2-methylbenzimidazol-1-yl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 40716431 |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.78 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 6-chloro-N-[2-(2-methylbenzimidazol-1-yl)ethyl]pyridine-3-carboxamide |
| SMILES | Cc1nc2ccccc2n1CCNC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H15ClN4O/c1-11-20-13-4-2-3-5-14(13)21(11)9-8-18-16(22)12-6-7-15(17)19-10-12/h2-7,10H,8-9H2,1H3,(H,18,22) |
| InChIKey | SABFXVICPFTJIE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.78 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|