C18H26N4O3 — CID 40716757
tert-butyl N-[3-[2-(2-methylbenzimidazol-1-yl)ethylamino]-3-oxopropyl]carbamate (PubChem CID 40716757) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is tert-butyl N-[3-[2-(2-methylbenzimidazol-1-yl)ethylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-(2-methylbenzimidazol-1-yl)ethylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 40716757 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | tert-butyl N-[3-[2-(2-methylbenzimidazol-1-yl)ethylamino]-3-oxopropyl]carbamate |
| SMILES | Cc1nc2ccccc2n1CCNC(=O)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26N4O3/c1-13-21-14-7-5-6-8-15(14)22(13)12-11-19-16(23)9-10-20-17(24)25-18(2,3)4/h5-8H,9-12H2,1-4H3,(H,19,23)(H,20,24) |
| InChIKey | BCBFAVNSWGGRGJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |