About 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide
3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide (PubChem CID 40716951) has the molecular formula C25H23N3O3
and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide.
Molecular Properties
| Compound Name | 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide |
| PubChem CID | 40716951 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide |
| SMILES | O=C(CCn1ccc2ccccc21)NNC(=O)COc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H23N3O3/c29-24(15-17-28-16-14-20-10-4-6-12-22(20)28)26-27-25(30)18-31-23-13-7-5-11-21(23)19-8-2-1-3-9-19/h1-14,16H,15,17-18H2,(H,26,29)(H,27,30) |
| InChIKey | VUTKGBXHISTBPZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide?
The IUPAC name of 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide (CID 40716951) is 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide.
What is the SMILES notation for 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide?
The canonical SMILES for 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide is O=C(CCn1ccc2ccccc21)NNC(=O)COc1ccccc1-c1ccccc1.
What is the InChIKey of 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide?
The InChIKey is VUTKGBXHISTBPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O3/c29-24(15-17-28-16-14-20-10-4-6-12-22(20)28)26-27-25(30)18-31-23-13-7-5-11-21(23)19-8-2-1-3-9-19/h1-14,16H,15,17-18H2,(H,26,29)(H,27,30).
What are the key properties of 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide?
3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide has a molecular weight of 413.48 g/mol, XLogP of 3.92, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-indol-1-yl-N'-[2-(2-phenylphenoxy)acetyl]propanehydrazide is sourced from PubChem (CID 40716951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).