C19H24N2O3S — CID 40718597
(10aR)-2-cyclohexyl-7,8-dimethoxy-3-sulfanylidene-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-1-one (PubChem CID 40718597) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is (10aR)-2-cyclohexyl-7,8-dimethoxy-3-sulfanylidene-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-1-one.
| Compound Name | (10aR)-2-cyclohexyl-7,8-dimethoxy-3-sulfanylidene-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-1-one |
|---|---|
| PubChem CID | 40718597 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (10aR)-2-cyclohexyl-7,8-dimethoxy-3-sulfanylidene-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-1-one |
| SMILES | COc1cc2c(cc1OC)CN1C(=S)N(C3CCCCC3)C(=O)[C@H]1C2 |
| InChI | InChI=1S/C19H24N2O3S/c1-23-16-9-12-8-15-18(22)21(14-6-4-3-5-7-14)19(25)20(15)11-13(12)10-17(16)24-2/h9-10,14-15H,3-8,11H2,1-2H3/t15-/m1/s1 |
| InChIKey | GUDYNPDMLYWECA-OAHLLOKOSA-N |
| XLogP | 2.89 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|