About 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one
3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one (PubChem CID 4072026) has the molecular formula C24H14N2O3S
and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one.
Molecular Properties
| Compound Name | 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one |
| PubChem CID | 4072026 |
| Molecular Formula | C24H14N2O3S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1cn2c(n1)sc1cc(Oc3ccccc3)ccc12 |
| InChI | InChI=1S/C24H14N2O3S/c27-23-18(12-15-6-4-5-9-21(15)29-23)19-14-26-20-11-10-17(13-22(20)30-24(26)25-19)28-16-7-2-1-3-8-16/h1-14H |
| InChIKey | OKAJRJNIMRDIRC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one?
The IUPAC name of 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one (CID 4072026) is 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one.
What is the SMILES notation for 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one?
The canonical SMILES for 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one is O=c1oc2ccccc2cc1-c1cn2c(n1)sc1cc(Oc3ccccc3)ccc12.
What is the InChIKey of 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one?
The InChIKey is OKAJRJNIMRDIRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14N2O3S/c27-23-18(12-15-6-4-5-9-21(15)29-23)19-14-26-20-11-10-17(13-22(20)30-24(26)25-19)28-16-7-2-1-3-8-16/h1-14H.
What are the key properties of 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one?
3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one has a molecular weight of 410.45 g/mol, XLogP of 6.11, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6-phenoxyimidazo[2,1-b][1,3]benzothiazol-2-yl)chromen-2-one is sourced from PubChem (CID 4072026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).