C18H16O4 — CID 4072199
tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,12-dicarboxylic acid (PubChem CID 4072199) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,12-dicarboxylic acid.
| Compound Name | tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,12-dicarboxylic acid |
|---|---|
| PubChem CID | 4072199 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | tricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaene-5,12-dicarboxylic acid |
| SMILES | O=C(O)c1cc2ccc1CCc1ccc(cc1C(=O)O)CC2 |
| InChI | InChI=1S/C18H16O4/c19-17(20)15-9-11-1-2-12-4-6-14(16(10-12)18(21)22)8-7-13(15)5-3-11/h3-6,9-10H,1-2,7-8H2,(H,19,20)(H,21,22) |
| InChIKey | JNUYMWWPGJJPEY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |