About 2-ethylhexanoate
2-ethylhexanoate (PubChem CID 4072356) has the molecular formula C8H15O2-
and a molecular weight of 143.21 g/mol. Its IUPAC name is 2-ethylhexanoate.
Molecular Properties
| Compound Name | 2-ethylhexanoate |
| PubChem CID | 4072356 |
| Molecular Formula | C8H15O2- |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 2-ethylhexanoate |
| SMILES | CCCCC(CC)C(=O)[O-] |
| InChI | InChI=1S/C8H16O2/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/p-1 |
| InChIKey | OBETXYAYXDNJHR-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanoate?
The IUPAC name of 2-ethylhexanoate (CID 4072356) is 2-ethylhexanoate.
What is the SMILES notation for 2-ethylhexanoate?
The canonical SMILES for 2-ethylhexanoate is CCCCC(CC)C(=O)[O-].
What is the InChIKey of 2-ethylhexanoate?
The InChIKey is OBETXYAYXDNJHR-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/p-1.
What are the key properties of 2-ethylhexanoate?
2-ethylhexanoate has a molecular weight of 143.21 g/mol, XLogP of 0.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanoate is sourced from PubChem (CID 4072356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).