About cycloheptane-1,3-dione
cycloheptane-1,3-dione (PubChem CID 4072367) has the molecular formula C7H10O2
and a molecular weight of 126.16 g/mol. Its IUPAC name is cycloheptane-1,3-dione.
Molecular Properties
| Compound Name | cycloheptane-1,3-dione |
| PubChem CID | 4072367 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | cycloheptane-1,3-dione |
| SMILES | O=C1CCCCC(=O)C1 |
| InChI | InChI=1S/C7H10O2/c8-6-3-1-2-4-7(9)5-6/h1-5H2 |
| InChIKey | DBOVMTXPZWVYAQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cycloheptane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptane-1,3-dione?
The IUPAC name of cycloheptane-1,3-dione (CID 4072367) is cycloheptane-1,3-dione.
What is the SMILES notation for cycloheptane-1,3-dione?
The canonical SMILES for cycloheptane-1,3-dione is O=C1CCCCC(=O)C1.
What is the InChIKey of cycloheptane-1,3-dione?
The InChIKey is DBOVMTXPZWVYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c8-6-3-1-2-4-7(9)5-6/h1-5H2.
What are the key properties of cycloheptane-1,3-dione?
cycloheptane-1,3-dione has a molecular weight of 126.16 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptane-1,3-dione is sourced from PubChem (CID 4072367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).