C22H25N3O2 — CID 40723884
4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(1R,2R)-2-methylcyclohexyl]benzamide (PubChem CID 40723884) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(1R,2R)-2-methylcyclohexyl]benzamide.
| Compound Name | 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(1R,2R)-2-methylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 40723884 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 4-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[(1R,2R)-2-methylcyclohexyl]benzamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)c1ccc(OCc2cn3ccccc3n2)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-16-6-2-3-7-20(16)24-22(26)17-9-11-19(12-10-17)27-15-18-14-25-13-5-4-8-21(25)23-18/h4-5,8-14,16,20H,2-3,6-7,15H2,1H3,(H,24,26)/t16-,20-/m1/s1 |
| InChIKey | PFLLYOPQKZXDTP-OXQOHEQNSA-N |
| XLogP | 4.22 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |