C20H25BrFNO2 — CID 40726029
(2R)-N-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]butan-2-amine (PubChem CID 40726029) has the molecular formula C20H25BrFNO2 and a molecular weight of 410.33 g/mol. Its IUPAC name is (2R)-N-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]butan-2-amine.
| Compound Name | (2R)-N-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 40726029 |
| Molecular Formula | C20H25BrFNO2 |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (2R)-N-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]butan-2-amine |
| SMILES | CCOc1cc(CN[C@H](C)CC)cc(Br)c1OCc1ccccc1F |
| InChI | InChI=1S/C20H25BrFNO2/c1-4-14(3)23-12-15-10-17(21)20(19(11-15)24-5-2)25-13-16-8-6-7-9-18(16)22/h6-11,14,23H,4-5,12-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | SJXSMJZWTYFLGU-CQSZACIVSA-N |
| XLogP | 5.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |