C13H20BrNO2 — CID 40726497
(2S)-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]butan-2-amine (PubChem CID 40726497) has the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. Its IUPAC name is (2S)-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]butan-2-amine.
| Compound Name | (2S)-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 40726497 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2S)-N-[(3-bromo-4,5-dimethoxyphenyl)methyl]butan-2-amine |
| SMILES | CC[C@H](C)NCc1cc(Br)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H20BrNO2/c1-5-9(2)15-8-10-6-11(14)13(17-4)12(7-10)16-3/h6-7,9,15H,5,8H2,1-4H3/t9-/m0/s1 |
| InChIKey | GPFTWELMAUCNTD-VIFPVBQESA-N |
| XLogP | 3.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |