C11H18N4O3 — CID 4072727
1-butyl-3-ethyl-4,5,7,9-tetrahydropurine-2,6,8-trione (PubChem CID 4072727) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-butyl-3-ethyl-4,5,7,9-tetrahydropurine-2,6,8-trione.
| Compound Name | 1-butyl-3-ethyl-4,5,7,9-tetrahydropurine-2,6,8-trione |
|---|---|
| PubChem CID | 4072727 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-butyl-3-ethyl-4,5,7,9-tetrahydropurine-2,6,8-trione |
| SMILES | CCCCN1C(=O)C2NC(=O)NC2N(CC)C1=O |
| InChI | InChI=1S/C11H18N4O3/c1-3-5-6-15-9(16)7-8(13-10(17)12-7)14(4-2)11(15)18/h7-8H,3-6H2,1-2H3,(H2,12,13,17) |
| InChIKey | RCDWSMRVDGNVAD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |