About N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine
N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (PubChem CID 40729103) has the molecular formula C11H9BrN4O2S2
and a molecular weight of 373.26 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
Molecular Properties
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| PubChem CID | 40729103 |
| Molecular Formula | C11H9BrN4O2S2 |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| SMILES | CN(Cc1ccc(Br)s1)c1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9BrN4O2S2/c1-14(6-7-2-3-8(12)20-7)9-10(16(17)18)15-4-5-19-11(15)13-9/h2-5H,6H2,1H3 |
| InChIKey | PNXZDNBAHMYRES-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine?
The IUPAC name of N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (CID 40729103) is N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine.
What is the SMILES notation for N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine?
The canonical SMILES for N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine is CN(Cc1ccc(Br)s1)c1nc2sccn2c1[N+](=O)[O-].
What is the InChIKey of N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine?
The InChIKey is PNXZDNBAHMYRES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrN4O2S2/c1-14(6-7-2-3-8(12)20-7)9-10(16(17)18)15-4-5-19-11(15)13-9/h2-5H,6H2,1H3.
What are the key properties of N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine?
N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine has a molecular weight of 373.26 g/mol, XLogP of 3.76, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-bromothiophen-2-yl)methyl]-N-methyl-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine is sourced from PubChem (CID 40729103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).