C17H17N3S — CID 40730381
(3aR,4S)-4-(5-methyl-1,3-thiazol-2-yl)-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4-carbonitrile (PubChem CID 40730381) has the molecular formula C17H17N3S and a molecular weight of 295.41 g/mol. Its IUPAC name is (3aR,4S)-4-(5-methyl-1,3-thiazol-2-yl)-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4-carbonitrile.
| Compound Name | (3aR,4S)-4-(5-methyl-1,3-thiazol-2-yl)-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 40730381 |
| Molecular Formula | C17H17N3S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (3aR,4S)-4-(5-methyl-1,3-thiazol-2-yl)-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4-carbonitrile |
| SMILES | Cc1cnc([C@@]2(C#N)Cc3ccccc3N3CCC[C@@H]32)s1 |
| InChI | InChI=1S/C17H17N3S/c1-12-10-19-16(21-12)17(11-18)9-13-5-2-3-6-14(13)20-8-4-7-15(17)20/h2-3,5-6,10,15H,4,7-9H2,1H3/t15-,17-/m1/s1 |
| InChIKey | JSRDWTGKRFEYHM-NVXWUHKLSA-N |
| XLogP | 3.44 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |