C20H26N4O3S — CID 40730777
(2S)-N-(cyclohexylcarbamoyl)-2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropanamide (PubChem CID 40730777) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is (2S)-N-(cyclohexylcarbamoyl)-2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-(cyclohexylcarbamoyl)-2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 40730777 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (2S)-N-(cyclohexylcarbamoyl)-2-[1-(4-methoxyphenyl)imidazol-2-yl]sulfanylpropanamide |
| SMILES | COc1ccc(-n2ccnc2S[C@@H](C)C(=O)NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H26N4O3S/c1-14(18(25)23-19(26)22-15-6-4-3-5-7-15)28-20-21-12-13-24(20)16-8-10-17(27-2)11-9-16/h8-15H,3-7H2,1-2H3,(H2,22,23,25,26)/t14-/m0/s1 |
| InChIKey | XNCIWFFLQGUMEV-AWEZNQCLSA-N |
| XLogP | 3.52 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |