C12H14N2O2 — CID 40731102
(3S,4aS,9aR)-2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate (PubChem CID 40731102) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (3S,4aS,9aR)-2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate.
| Compound Name | (3S,4aS,9aR)-2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 40731102 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (3S,4aS,9aR)-2,3,4,4a,9,9a-hexahydro-1H-pyrido[3,4-b]indol-2-ium-3-carboxylate |
| SMILES | O=C([O-])[C@@H]1C[C@H]2c3ccccc3N[C@H]2C[NH2+]1 |
| InChI | InChI=1S/C12H14N2O2/c15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10/h1-4,8,10-11,13-14H,5-6H2,(H,15,16)/t8-,10-,11-/m0/s1 |
| InChIKey | XNQLMEKQPNBFCY-LSJOCFKGSA-N |
| XLogP | -1.35 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |