C14H25N2O2S+ — CID 4073183
1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-ethylsulfonylpiperazin-1-ium (PubChem CID 4073183) has the molecular formula C14H25N2O2S+ and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-ethylsulfonylpiperazin-1-ium.
| Compound Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-ethylsulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 4073183 |
| Molecular Formula | C14H25N2O2S+ |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]hept-5-enylmethyl)-4-ethylsulfonylpiperazin-1-ium |
| SMILES | CCS(=O)(=O)N1CC[NH+](CC2CC3C=CC2C3)CC1 |
| InChI | InChI=1S/C14H24N2O2S/c1-2-19(17,18)16-7-5-15(6-8-16)11-14-10-12-3-4-13(14)9-12/h3-4,12-14H,2,5-11H2,1H3/p+1 |
| InChIKey | YEUSQQDGKPZLMN-UHFFFAOYSA-O |
| XLogP | -0.25 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|