C34H35N3O7S — CID 40736110
ethyl (2Z,5R)-2-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-(2,5-dimethoxyphenyl)-3-oxo-7-propyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 40736110) has the molecular formula C34H35N3O7S and a molecular weight of 629.74 g/mol. Its IUPAC name is ethyl (2Z,5R)-2-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-(2,5-dimethoxyphenyl)-3-oxo-7-propyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl (2Z,5R)-2-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-(2,5-dimethoxyphenyl)-3-oxo-7-propyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 40736110 |
| Molecular Formula | C34H35N3O7S |
| Molecular Weight | 629.74 g/mol |
| Exact Mass | 629.22 |
| IUPAC Name | ethyl (2Z,5R)-2-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-(2,5-dimethoxyphenyl)-3-oxo-7-propyl-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CCCC1=C(C(=O)OCC)[C@@H](c2cc(OC)ccc2OC)n2c(s/c(=C\c3cc(C)n(-c4ccc5c(c4)OCO5)c3C)c2=O)=N1 |
| InChI | InChI=1S/C34H35N3O7S/c1-7-9-25-30(33(39)42-8-2)31(24-17-23(40-5)11-13-26(24)41-6)37-32(38)29(45-34(37)35-25)15-21-14-19(3)36(20(21)4)22-10-12-27-28(16-22)44-18-43-27/h10-17,31H,7-9,18H2,1-6H3/b29-15-/t31-/m1/s1 |
| InChIKey | VLCHLUUQIWRCRK-JJHILCALSA-N |
| XLogP | 4.73 |
| TPSA | 102.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.74 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|