C31H24ClNO2S — CID 40736345
(4aR,6R)-6-(3-chlorophenyl)-3-methyl-2,4a-diphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one (PubChem CID 40736345) has the molecular formula C31H24ClNO2S and a molecular weight of 510.06 g/mol. Its IUPAC name is (4aR,6R)-6-(3-chlorophenyl)-3-methyl-2,4a-diphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one.
| Compound Name | (4aR,6R)-6-(3-chlorophenyl)-3-methyl-2,4a-diphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one |
|---|---|
| PubChem CID | 40736345 |
| Molecular Formula | C31H24ClNO2S |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | (4aR,6R)-6-(3-chlorophenyl)-3-methyl-2,4a-diphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one |
| SMILES | CC1=C(c2ccccc2)C(=O)N2c3ccccc3S[C@@H](c3cccc(Cl)c3)C[C@]2(c2ccccc2)O1 |
| InChI | InChI=1S/C31H24ClNO2S/c1-21-29(22-11-4-2-5-12-22)30(34)33-26-17-8-9-18-27(26)36-28(23-13-10-16-25(32)19-23)20-31(33,35-21)24-14-6-3-7-15-24/h2-19,28H,20H2,1H3/t28-,31-/m1/s1 |
| InChIKey | DRETWWPBMDMJFM-GRKNLSHJSA-N |
| XLogP | 8.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |