C29H22BrNOS — CID 40736423
(4R,5R,7R)-7-(4-bromophenyl)-4,5-diphenyl-8-thia-2-azatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one (PubChem CID 40736423) has the molecular formula C29H22BrNOS and a molecular weight of 512.47 g/mol. Its IUPAC name is (4R,5R,7R)-7-(4-bromophenyl)-4,5-diphenyl-8-thia-2-azatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one.
| Compound Name | (4R,5R,7R)-7-(4-bromophenyl)-4,5-diphenyl-8-thia-2-azatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one |
|---|---|
| PubChem CID | 40736423 |
| Molecular Formula | C29H22BrNOS |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | (4R,5R,7R)-7-(4-bromophenyl)-4,5-diphenyl-8-thia-2-azatricyclo[7.4.0.02,5]trideca-1(13),9,11-trien-3-one |
| SMILES | O=C1[C@H](c2ccccc2)[C@@]2(c3ccccc3)C[C@H](c3ccc(Br)cc3)Sc3ccccc3N12 |
| InChI | InChI=1S/C29H22BrNOS/c30-23-17-15-20(16-18-23)26-19-29(22-11-5-2-6-12-22)27(21-9-3-1-4-10-21)28(32)31(29)24-13-7-8-14-25(24)33-26/h1-18,26-27H,19H2/t26-,27+,29+/m1/s1 |
| InChIKey | DLIAIWYTQNNQLR-XQFUHLNNSA-N |
| XLogP | 7.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |