C32H27NO2S — CID 40736446
(4aR,6R)-3-benzyl-6-methyl-2,4a-diphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one (PubChem CID 40736446) has the molecular formula C32H27NO2S and a molecular weight of 489.64 g/mol. Its IUPAC name is (4aR,6R)-3-benzyl-6-methyl-2,4a-diphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one.
| Compound Name | (4aR,6R)-3-benzyl-6-methyl-2,4a-diphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one |
|---|---|
| PubChem CID | 40736446 |
| Molecular Formula | C32H27NO2S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | (4aR,6R)-3-benzyl-6-methyl-2,4a-diphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one |
| SMILES | C[C@@H]1C[C@]2(c3ccccc3)OC(Cc3ccccc3)=C(c3ccccc3)C(=O)N2c2ccccc2S1 |
| InChI | InChI=1S/C32H27NO2S/c1-23-22-32(26-17-9-4-10-18-26)33(27-19-11-12-20-29(27)36-23)31(34)30(25-15-7-3-8-16-25)28(35-32)21-24-13-5-2-6-14-24/h2-20,23H,21-22H2,1H3/t23-,32-/m1/s1 |
| InChIKey | USUHTPKLGZNRCC-JIYROHSKSA-N |
| XLogP | 7.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |