C24H23N5O7S — CID 40736767
[4-methoxy-2-[(6R)-3-methylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-6-nitrophenyl] propanoate (PubChem CID 40736767) has the molecular formula C24H23N5O7S and a molecular weight of 525.54 g/mol. Its IUPAC name is [4-methoxy-2-[(6R)-3-methylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-6-nitrophenyl] propanoate.
| Compound Name | [4-methoxy-2-[(6R)-3-methylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-6-nitrophenyl] propanoate |
|---|---|
| PubChem CID | 40736767 |
| Molecular Formula | C24H23N5O7S |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | [4-methoxy-2-[(6R)-3-methylsulfanyl-7-propanoyl-6H-[1,2,4]triazino[5,6-d][3,1]benzoxazepin-6-yl]-6-nitrophenyl] propanoate |
| SMILES | CCC(=O)Oc1c([C@H]2Oc3nc(SC)nnc3-c3ccccc3N2C(=O)CC)cc(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H23N5O7S/c1-5-18(30)28-16-10-8-7-9-14(16)20-22(25-24(37-4)27-26-20)36-23(28)15-11-13(34-3)12-17(29(32)33)21(15)35-19(31)6-2/h7-12,23H,5-6H2,1-4H3/t23-/m1/s1 |
| InChIKey | JMIGFPGHLXXROX-HSZRJFAPSA-N |
| XLogP | 4.33 |
| TPSA | 146.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|