C21H19Br2N3S — CID 40736967
(3S,3aS,7E)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide (PubChem CID 40736967) has the molecular formula C21H19Br2N3S and a molecular weight of 505.28 g/mol. Its IUPAC name is (3S,3aS,7E)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide.
| Compound Name | (3S,3aS,7E)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide |
|---|---|
| PubChem CID | 40736967 |
| Molecular Formula | C21H19Br2N3S |
| Molecular Weight | 505.28 g/mol |
| Exact Mass | 502.97 |
| IUPAC Name | (3S,3aS,7E)-3-(4-bromophenyl)-7-[(4-bromophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C2/C(=C/c3ccc(Br)cc3)CCC[C@H]2[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H19Br2N3S/c22-16-8-4-13(5-9-16)12-15-2-1-3-18-19(15)25-26(21(24)27)20(18)14-6-10-17(23)11-7-14/h4-12,18,20H,1-3H2,(H2,24,27)/b15-12+/t18-,20-/m1/s1 |
| InChIKey | LNVDFWSXWHQIFM-HRQWZESXSA-N |
| XLogP | 6.05 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.28 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|