About pyridin-1-ium-1-yl N,N-dimethylcarbamate
pyridin-1-ium-1-yl N,N-dimethylcarbamate (PubChem CID 4073854) has the molecular formula C8H11N2O2+
and a molecular weight of 167.19 g/mol. Its IUPAC name is pyridin-1-ium-1-yl N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | pyridin-1-ium-1-yl N,N-dimethylcarbamate |
| PubChem CID | 4073854 |
| Molecular Formula | C8H11N2O2+ |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | pyridin-1-ium-1-yl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)O[n+]1ccccc1 |
| InChI | InChI=1S/C8H11N2O2/c1-9(2)8(11)12-10-6-4-3-5-7-10/h3-7H,1-2H3/q+1 |
| InChIKey | RHWIICZSOWZUJY-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-1-ium-1-yl N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-1-ium-1-yl N,N-dimethylcarbamate?
The IUPAC name of pyridin-1-ium-1-yl N,N-dimethylcarbamate (CID 4073854) is pyridin-1-ium-1-yl N,N-dimethylcarbamate.
What is the SMILES notation for pyridin-1-ium-1-yl N,N-dimethylcarbamate?
The canonical SMILES for pyridin-1-ium-1-yl N,N-dimethylcarbamate is CN(C)C(=O)O[n+]1ccccc1.
What is the InChIKey of pyridin-1-ium-1-yl N,N-dimethylcarbamate?
The InChIKey is RHWIICZSOWZUJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N2O2/c1-9(2)8(11)12-10-6-4-3-5-7-10/h3-7H,1-2H3/q+1.
What are the key properties of pyridin-1-ium-1-yl N,N-dimethylcarbamate?
pyridin-1-ium-1-yl N,N-dimethylcarbamate has a molecular weight of 167.19 g/mol, XLogP of 0.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-1-ium-1-yl N,N-dimethylcarbamate is sourced from PubChem (CID 4073854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).